CAS 157707-92-1
:2-O-(O-nitrophenyl)-A-D-N-*acetylneuraminic acid
Description:
2-O-(O-nitrophenyl)-A-D-N-acetylneuraminic acid, identified by its CAS number 157707-92-1, is a derivative of sialic acid, which is a family of nine-carbon sugars known for their role in cellular recognition and signaling. This compound features a nitrophenyl group at the 2-O position, which enhances its reactivity and potential applications in biochemical research. The acetyl group at the amino position contributes to its stability and solubility in organic solvents. As a sialic acid derivative, it may participate in various biological processes, including cell-cell interactions and pathogen recognition. Its unique structure allows it to serve as a valuable tool in studies related to glycoproteins and glycolipids, particularly in understanding the role of sialic acids in immunity and cellular communication. Additionally, the nitrophenyl moiety can facilitate detection methods in laboratory settings, making it useful in assays and other analytical techniques. Overall, this compound is significant in both synthetic and biological chemistry contexts.
Formula:C17H22N2O11
InChI:InChI=1/C17H22N2O11/c1-8(21)18-13-10(22)6-17(16(25)26,30-15(13)14(24)11(23)7-20)29-12-5-3-2-4-9(12)19(27)28/h2-5,10-11,13-15,20,22-24H,6-7H2,1H3,(H,18,21)(H,25,26)
SMILES:CC(=NC1C(CC(C(=O)O)(Oc2ccccc2N(=O)=O)OC1C(C(CO)O)O)O)O
Synonyms:- 2-Nitrophenyl 5-(Acetylamino)-3,5-Dideoxynon-2-Ulopyranosidonic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-O-(2-Nitrophenyl)-a-D-N-acetylneuraminic acid
CAS:2-O-(2-Nitrophenyl)-a-D-N-acetylneuraminic acid is a chromogenic substrate specifically designed for the detection and quantification of sialidase (neuraminidase) enzyme activity. Neuraminidases are enzymes that cleave sialic acid residues from glycoconjugates, and are produced by many microorganisms, including influenza viruses. Upon cleavage by sialidase, this substrate releases a yellow-colored 2-nitrophenol product, which can be easily monitored spectrophotometrically. This substrate is widely used in various applications, including enzyme kinetics studies, inhibitor screening, and the detection of bacterial and viral neuraminidases in clinical and environmental samples.Purity:Min. 95%Color and Shape:SolidMolecular weight:430.36 g/mol

