CAS 15777-44-3

N-(5-BUTYL-[1,3,4]THIADIAZOL-2-YL)-2-CHLORO-ACETAMIDE

Description:

N-(5-Butyl-[1,3,4]thiadiazol-2-yl)-2-chloroacetamide is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a chloroacetamide functional group. The presence of the butyl group enhances its hydrophobic properties, potentially influencing its solubility and biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. The thiadiazole moiety is often associated with diverse biological activities, including antimicrobial and anti-inflammatory effects. The chloroacetamide group can participate in nucleophilic substitution reactions, which may be relevant in synthetic applications. Additionally, the compound's stability, reactivity, and interactions with biological targets can be influenced by its molecular structure. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, N-(5-butyl-[1,3,4]thiadiazol-2-yl)-2-chloroacetamide represents a compound with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₈H₁₂ClN₃OS

InChI: InChI=1/C8H12ClN3OS/c1-2-3-4-7-11-12-8(14-7)10-6(13)5-9/h2-5H2,1H3,(H,10,12,13)

SMILES: CCCCc1nnc(N=C(CCl)O)s1

Synonyms:

• Acetamide, N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-chloro-
• N-(5-Butyl-1,3,4-thiadiazol-2-yl)-2-chloroacetamide

N-(5-Butyl-1,3,4-thiadiazol-2-yl)-2-chloroacetamide

CAS: 15777-44-3

Versatile small molecule scaffold

Formula: C₈H₁₂ClN₃OS

Purity: Min. 95%

Molecular weight: 233.72 g/mol

Ref: 3D-QAA77744