CAS 15777-70-5

4-Hydroxy-3-methylbenzonitrile

Description:

4-Hydroxy-3-methylbenzonitrile, with the CAS number 15777-70-5, is an organic compound characterized by the presence of a hydroxyl group (-OH) and a nitrile group (-C≡N) attached to a benzene ring. This compound features a methyl group (-CH₃) at the meta position relative to the hydroxyl group, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group, while the nitrile group can influence its reactivity and polarity. The presence of both functional groups allows for potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, making it a versatile intermediate in synthetic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₇NO

InChI: InChI=1S/C8H7NO/c1-6-4-7(5-9)2-3-8(6)10/h2-4,10H,1H3

InChI key: InChIKey=WTTADDGUHFYGEH-UHFFFAOYSA-N

SMILES: C(#N)C1=CC(C)=C(O)C=C1

Synonyms:

• Benzonitrile, 4-hydroxy-3-methyl-
• 4,3-Cresotonitrile
• 2-Methyl-4-cyanophenol
• 3-Methyl-4-hydroxybenzonitrile
• 4-Hydroxy-3-methylbenzonitrile

Benzonitrile, 4-hydroxy-3-methyl-

CAS: 15777-70-5

Formula: C₈H₇NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 133.1473

Ref: IN-DA001PPE

4-Hydroxy-3-methylbenzonitrile

CAS: 15777-70-5

4-Hydroxy-3-methylbenzonitrile

Purity: 98%

Molecular weight: 133.15g/mol

Ref: 54-OR908148

4-Hydroxy-3-methyl benzonitrile

CAS: 15777-70-5

Formula: C₈H₇NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 133.15

Ref: 10-F053331