CAS 1578-57-0
:2-fluorohexanoic acid
Description:
2-Fluorohexanoic acid is a fluorinated carboxylic acid characterized by the presence of a fluorine atom at the second carbon position of a six-carbon hexanoic acid chain. Its molecular formula is C6H11F O2, and it features a carboxylic acid functional group (-COOH), which imparts acidic properties. The presence of the fluorine atom influences its chemical reactivity and physical properties, such as solubility and boiling point. Typically, fluorinated compounds exhibit increased lipophilicity and altered biological activity compared to their non-fluorinated counterparts. 2-Fluorohexanoic acid is of interest in various fields, including organic synthesis and materials science, due to its potential applications in the development of fluorinated intermediates and pharmaceuticals. Additionally, it may be studied for its environmental impact and behavior, as fluorinated compounds can persist in the environment. Safety considerations are important when handling this substance, as with many fluorinated organic compounds, due to potential toxicity and environmental concerns.
Formula:C6H11FO2
InChI:InChI=1/C6H11FO2/c1-2-3-4-5(7)6(8)9/h5H,2-4H2,1H3,(H,8,9)
SMILES:CCCCC(C(=O)O)F
Synonyms:- Hexanoic acid, 2-fluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Fluorohexanoic Acid
CAS:Controlled ProductFormula:C6H11FO2Color and Shape:NeatMolecular weight:134.1492-Fluorohexanoic acid
CAS:<p>2-Fluorohexanoic acid is a synthetic chemical that belongs to the group of fluorinated aliphatic acids. It has been shown to inhibit the NS3 protease from hepatitis C virus. The hydroxy group on the 2-fluorohexanoic acid molecule allows it to cleave peptide bonds in proteins, which are necessary for their function. This chemical can be used as a linker between two proteins or other molecules that need to be attached together.</p>Formula:C6H11FO2Purity:Min. 95%Color and Shape:PowderMolecular weight:134.15 g/mol
