CAS 15780-96-8
:Phosphonic acid, decyl phenyl ester
Description:
Phosphonic acid, decyl phenyl ester, also known by its CAS number 15780-96-8, is an organophosphorus compound characterized by the presence of a phosphonic acid functional group esterified with a decyl phenyl moiety. This compound typically exhibits properties associated with both phosphonic acids and esters, including moderate solubility in organic solvents and limited solubility in water due to its hydrophobic alkyl chain. It is often utilized in various applications, including as a surfactant, in agrochemicals, and in the synthesis of other chemical compounds. The presence of the phenyl group contributes to its aromatic characteristics, which can influence its reactivity and interactions with other substances. Additionally, phosphonic acids are known for their ability to form stable complexes with metal ions, making them useful in chelation processes. Safety data should be consulted for handling and exposure guidelines, as organophosphorus compounds can exhibit varying degrees of toxicity and environmental impact.
Formula:C16H27O3P
InChI:InChI=1S/C16H27O3P/c1-2-3-4-5-6-7-8-12-15-18-20(17)19-16-13-10-9-11-14-16/h9-11,13-14,20H,2-8,12,15H2,1H3
InChI key:InChIKey=AMOYHOKJLMHCLR-UHFFFAOYSA-N
SMILES:O(P(OCCCCCCCCCC)=O)C1=CC=CC=C1
Synonyms:- Phosphonic acid, decyl phenyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
