CymitQuimica logo

CAS 157824-23-2

:

[(1S)-5,6-dichloro-2,3-dihydro-1H-inden-1-yl][(3R)-3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]methanone hydrochloride (1:1)

Description:
The chemical substance with the name "[(1S)-5,6-dichloro-2,3-dihydro-1H-inden-1-yl][(3R)-3-(pyrrolidin-1-ylmethyl)thiomorpholin-4-yl]methanone hydrochloride (1:1)" and CAS number 157824-23-2 is a complex organic compound characterized by its unique structural features, including a dichloroindene moiety and a thiomorpholine derivative. This compound exhibits a chiral center, which contributes to its stereochemistry and potential biological activity. The presence of the pyrrolidine and thiomorpholine rings suggests that it may interact with biological targets, possibly influencing neurotransmitter systems or other physiological pathways. As a hydrochloride salt, it is likely to be more soluble in water, enhancing its bioavailability for pharmacological applications. The compound's synthesis and characterization would typically involve advanced organic chemistry techniques, and its properties, such as melting point, solubility, and stability, would be essential for understanding its potential uses in medicinal chemistry or drug development. Further studies would be necessary to elucidate its mechanism of action and therapeutic potential.
Formula:C19H25Cl3N2OS
InChI:InChI=1/C19H24Cl2N2OS.ClH/c20-17-9-13-3-4-15(16(13)10-18(17)21)19(24)23-7-8-25-12-14(23)11-22-5-1-2-6-22;/h9-10,14-15H,1-8,11-12H2;1H/t14-,15+;/m1./s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • R-84760 hydrochloride

    CAS:
    <p>R-84760, a potent κ-opioid receptor agonist, relieves tonic pain via supraspinal/spinal pathways, activating noradrenergic descent.</p>
    Formula:C19H25Cl3N2OS
    Color and Shape:Solid
    Molecular weight:435.84