CAS 157843-41-9

2-Chloro-4-nitrophenyl-alpha-L-fucopyranoside

Description:

2-Chloro-4-nitrophenyl-alpha-L-fucopyranoside is a chemical compound that belongs to the class of glycosides, specifically a fucoside. It features a fucose sugar moiety linked to a 2-chloro-4-nitrophenyl group, which contributes to its reactivity and potential applications in biochemical research. The presence of the nitro and chloro substituents on the aromatic ring enhances its electrophilic character, making it useful in various synthetic pathways and as a substrate in enzymatic reactions. This compound is often utilized in studies related to glycosylation processes and carbohydrate chemistry. Its solubility characteristics typically allow it to dissolve in polar solvents, facilitating its use in laboratory settings. Additionally, due to its structural features, it may exhibit specific biological activities, making it of interest in pharmacological research. Safety data should be consulted for handling, as the presence of chlorine and nitro groups can imply potential hazards. Overall, 2-Chloro-4-nitrophenyl-alpha-L-fucopyranoside serves as a valuable tool in the exploration of glycosidic bonds and carbohydrate interactions.

Formula: C₁₂H₁₄ClNO₇

InChI: InChI=1/C12H14ClNO7/c1-5-9(15)10(16)11(17)12(20-5)21-8-3-2-6(14(18)19)4-7(8)13/h2-5,9-12,15-17H,1H3/t5-,9+,10+,11-,12-/m0/s1

Synonyms:

• Cnp-Afu
• 2-Chloro-4-nitrophenyl-α-L-fucopyranoside

α-L-Galactopyranoside, 2-chloro-4-nitrophenyl 6-deoxy-

CAS: 157843-41-9

Formula: C₁₂H₁₄ClNO₇

Purity: %

Color and Shape: Solid

Molecular weight: 319.6951

Ref: IN-DA001PR6

2-Chloro-4-Nitrophenyl-α-L-Fucopyranoside

CAS: 157843-41-9

2-Chloro-4-Nitrophenyl-α-L-Fucopyranoside

Purity: 98%

Molecular weight: 319.7g/mol

Ref: 54-OR1026476

CNP-AFU

CAS: 157843-41-9

CNP-AFU

Purity: ≥95%

Molecular weight: 319.7g/mol

Ref: 54-BUP11838

2-Chloro-4-nitrophenyl a-L-fucopyranoside

CAS: 157843-41-9

Formula: C₁₂H₁₄ClNO₇

Purity: ≥ 98.0%

Color and Shape: White to off-white powder

Molecular weight: 319.69

Ref: 7W-GC6102

2-Chloro-4-nitrophenyl-alpha-L-fucopyranoside

CAS: 157843-41-9

Alternative chromogenic substrate for alpha-D-galactosidase

Formula: C₁₂H₁₄ClNO₇

Purity: Min. 98 Area-%

Color and Shape: White Powder

Molecular weight: 319.69 g/mol

Ref: 3D-EC05990

2-Chloro-4-Nitrophenyl a-L-Fucopyranoside (CNPF) extrapure, 98%

CAS: 157843-41-9

Formula: C₁₂H₁₄ClNO₇

Molecular weight: 319.7

Ref: SR-21259

α-L-Galactopyranoside, 2-chloro-4-nitrophenyl 6-deoxy-

CAS: 157843-41-9

Purity: 98%

Molecular weight: 319.69

Ref: 10-F980095

CNP-AFU

CAS: 157843-41-9

CNP-AFU (2-Chloro-4-nitrophenyl α-L-fucopyranoside) is the substrate of alpha-L-fucosidase.

Formula: C₁₂H₁₄ClNO₇

Purity: 99.55%

Color and Shape: White To Off-White Solid

Molecular weight: 319.7

Ref: TM-T19244

2-Chloro-4-nitrophenyl-α-L-fucopyranoside

CAS: 157843-41-9

2-Chloro-4-nitrophenyl-alpha-L-fucopyranoside is a compound that is commonly used as an enzyme substrate for glycogen synthase kinase (GSK). It is activated by GSK-3β and has been shown to inhibit the activity of this enzyme. This compound has also been found to have inhibitory effects on other enzymes such as carbonic anhydrase and lactate dehydrogenase. Additionally, 2-Chloro-4-nitrophenyl-alpha-L-fucopyranoside exhibits antifungal activity against various fungi, including those resistant to other antifungal agents such as fluopyram and prothioconazole. Its mechanism of action involves interfering with ergosterol biosynthesis, an essential component of fungal cell membranes. Furthermore, this compound has potential applications in the development of new drugs targeting GSK-3β and β-catenin signaling pathways, which are implicated in various diseases including cancer and neuro

Formula: C₁₂H₁₄ClNO₇

Purity: Min. 98 Area-%

Molecular weight: 319.7 g/mol

Ref: 3D-C-5224