CAS 157878-03-0
:cytosaminomycin B
Description:
Cytosaminomycin B is a natural product classified as an antibiotic, derived from certain microbial sources. It is known for its potential therapeutic applications, particularly in the field of oncology, due to its ability to inhibit protein synthesis in cancer cells. The compound exhibits a complex structure, which includes multiple functional groups that contribute to its biological activity. Cytosaminomycin B is characterized by its specific mechanism of action, which involves interference with the ribosomal function, ultimately leading to cell death in susceptible organisms. Additionally, it has shown activity against various bacterial strains, making it a subject of interest for further research in antibiotic development. Its chemical properties, such as solubility and stability, are influenced by its molecular structure, which can affect its efficacy and bioavailability. As with many antibiotics, the potential for resistance development is a critical consideration in its use. Overall, cytosaminomycin B represents a significant area of study in medicinal chemistry and microbiology, highlighting the ongoing search for effective antimicrobial agents.
Formula:C26H37N5O8
InChI:InChI=1/C26H37N5O8/c1-13-20(30(4)5)21(33)22(34)25(38-13)39-23-14(2)37-19(12-17(23)32)31-11-10-18(29-26(31)36)28-24(35)15-6-8-16(27-3)9-7-15/h6-11,13-14,17,19-23,25,27,32-34H,12H2,1-5H3,(H,28,29,35,36)/t13-,14+,17+,19+,20-,21+,22-,23+,25-/m1/s1
Synonyms:- Benzamide, N-[1-[2,6-dideoxy-4-O-[4,6-dideoxy-4-(dimethylamino)-α-D-glucopyranosyl]-β-D-arabino-hexopyranosyl]-1,2-dihydro-2-oxo-4-pyrimidinyl]-4-(methylamino)-
- cytosaminomycin B
- 2(1H)-pyrimidinone, 1-[2,6-dideoxy-4-O-[4,6-dideoxy-4-(dimethylamino)-alpha-D-glucopyranosyl]-beta-L-arabino-hexopyranosyl]-4-[[4-(methylamino)benzoyl]amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cytosaminomycin B
CAS:Cytosaminomycin B exhibits activity against Eimeria Tenella coccidia.Formula:C26H37N5O8Color and Shape:SolidMolecular weight:547.601
