CymitQuimica logo

CAS 157878-04-1

:

cytosaminomycin C

Description:
Cytosaminomycin C is a natural product classified as an antibiotic, derived from the fermentation of specific microbial strains. It exhibits a complex molecular structure characterized by a unique combination of amino acids and sugar moieties, contributing to its biological activity. This compound is known for its potential antitumor properties, as it can interfere with cellular processes, particularly in cancer cells. Cytosaminomycin C operates through mechanisms such as inhibiting protein synthesis and disrupting nucleic acid function, which are critical for cell growth and proliferation. Its efficacy and specificity make it a subject of interest in pharmaceutical research, particularly in the development of novel cancer therapies. Additionally, the compound's stability, solubility, and interaction with other biological molecules are important factors that influence its therapeutic potential and application in clinical settings. As with many antibiotics, understanding its pharmacokinetics and potential side effects is crucial for safe and effective use in medical treatments.
Formula:C23H36N4O8
InChI:InChI=1/C23H36N4O8/c1-11(2)9-16(29)24-15-7-8-27(23(32)25-15)17-10-14(28)21(13(4)33-17)35-22-20(31)19(30)18(26(5)6)12(3)34-22/h7-9,12-14,17-22,28,30-31H,10H2,1-6H3,(H,24,25,29,32)/t12-,13-,14-,17-,18-,19+,20-,21-,22-/m1/s1
Synonyms:
  • 2-Butenamide, N-[1-[2,6-dideoxy-4-O-[4,6-dideoxy-4-(dimethylamino)-α-D-glucopyranosyl]-β-D-arabino-hexopyranosyl]-1,2-dihydro-2-oxo-4-pyrimidinyl]-3-methyl-
  • cytosaminomycin C
  • 2(1H)-pyrimidinone, 1-[2,6-dideoxy-4-O-[4,6-dideoxy-4-(dimethylamino)-alpha-D-glucopyranosyl]-beta-D-arabino-hexopyranosyl]-4-[(3-methyl-1-oxo-2-buten-1-yl)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.