CAS 15790-94-0

trans-2-Undecenoic acid

Description:

Trans-2-Undecenoic acid is a fatty acid characterized by its long carbon chain and the presence of a double bond in the trans configuration. It has a molecular formula of C11H20O2, indicating it contains 11 carbon atoms, 20 hydrogen atoms, and 2 oxygen atoms. This compound is typically a colorless to pale yellow liquid with a distinct fatty odor. The trans configuration of the double bond contributes to its unique physical properties, such as a higher melting point compared to its cis counterparts. Trans-2-Undecenoic acid is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. It is used in various applications, including as a flavoring agent, in the synthesis of esters, and in the production of surfactants. Additionally, it has been studied for its potential antimicrobial properties. As with many fatty acids, it can undergo reactions typical of carboxylic acids, such as esterification and oxidation.

Formula: C₁₁H₂₀O₂

InChI: InChI=1S/C11H20O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h9-10H,2-8H2,1H3,(H,12,13)/b10-9+

InChI key: InChIKey=IGBBVTAVILYDIO-MDZDMXLPSA-N

SMILES: C(CCCCCC)C/C=C/C(O)=O

Synonyms:

• (2E)-2-Undecenoic acid
• (2E)-undec-2-enoic acid
• (E)-2-Undecenoic acid
• 2-Undecenoic acid, (2E)-
• 2-Undecenoic acid, (E)-
• 2-trans-Undecenoic acid
• trans-2-Undecenoic acid

2-Undecenoic acid, (2E)-

CAS: 15790-94-0

Formula: C₁₁H₂₀O₂

Purity: %

Color and Shape: Solid

Molecular weight: 184.2753

Ref: IN-DA001PTD

(E)-Undec-2-Enoic Acid

CAS: 15790-94-0

(E)-Undec-2-Enoic Acid

Purity: 95%

Molecular weight: 184.28g/mol

Ref: 54-OR1008372

trans-2-Undecenoic acid

CAS: 15790-94-0

trans-2-Undecenoic acid

Purity: ≥95%

Molecular weight: 184.28g/mol

Ref: 54-BUP18784

trans-2-Undecenoic acid

CAS: 15790-94-0

trans-2-Undecenoic acid ((E)-Undec-2-enoic acid) ((E)-2-Undecenoic acid) is an α,β-unsaturated carboxylic acid and is characterized by acid dimers.

Formula: C₁₁H₂₀O₂

Purity: 97.82%

Color and Shape: Solid

Molecular weight: 184.28

Ref: TM-T19589

trans-2-Undecenoic acid

CAS: 15790-94-0

Purity: 95+%

Molecular weight: 184.279007

Ref: 10-F606477

Trans-2-undecenoic acid

CAS: 15790-94-0

Trans-2-undecenoic acid is a synthetic compound, which is primarily derived from the unsaturated fatty acids found in various plant oils. It exhibits a unique molecular structure featuring a double bond configuration that imparts specific chemical properties, making the compound versatile for scientific applications.

Formula: C₁₁H₂₀O₂

Purity: Min. 95%

Molecular weight: 184.27 g/mol

Ref: 3D-QAA79094