CymitQuimica logo

CAS 1579991-63-1

:

6-(Dimethylamino)-2-[2-[[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]amino]ethyl]-1H-benz[de]isoquinoline-1,3(2H)-dione

Description:
6-(Dimethylamino)-2-[2-[[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]amino]ethyl]-1H-benz[de]isoquinoline-1,3(2H)-dione is a complex organic compound characterized by its unique structural features, which include a benz[de]isoquinoline core, a thiadiazole moiety, and a dimethylamino group. This compound is likely to exhibit properties typical of heterocyclic compounds, such as potential biological activity, given the presence of nitrogen-containing rings. The dimethylamino group may enhance its solubility and reactivity, while the thiadiazole ring could contribute to its pharmacological properties. The presence of multiple functional groups suggests that it may engage in various chemical interactions, making it of interest in medicinal chemistry and drug development. Additionally, the compound's molecular structure indicates potential for applications in fields such as biochemistry and materials science. However, specific characteristics such as melting point, solubility, and spectral data would require empirical investigation or reference to specialized databases for precise information.
Formula:C20H21N5O2S
InChI:InChI=1S/C20H21N5O2S/c1-12-22-23-17(28-12)11-21-9-10-25-19(26)14-6-4-5-13-16(24(2)3)8-7-15(18(13)14)20(25)27/h4-8,21H,9-11H2,1-3H3
InChI key:InChIKey=MZVBLDCRQKXSHR-UHFFFAOYSA-N
SMILES:N(C)(C)C=1C2=C3C(C(=O)N(CCNCC4=NN=C(C)S4)C(=O)C3=CC=C2)=CC1
Synonyms:
  • 1H-Benz[de]isoquinoline-1,3(2H)-dione, 6-(dimethylamino)-2-[2-[[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]amino]ethyl]-
  • 6-(Dimethylamino)-2-[2-[[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]amino]ethyl]-1H-benz[de]isoquinoline-1,3(2H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.