CymitQuimica logo

CAS 1580-20-7

:

1,2,3,4,5,6,7,8,9,10-decafluorophenanthrene

Description:
1,2,3,4,5,6,7,8,9,10-decafluorophenanthrene is a fluorinated aromatic compound characterized by the presence of ten fluorine atoms attached to a phenanthrene backbone. This compound is notable for its high degree of fluorination, which significantly alters its physical and chemical properties compared to non-fluorinated analogs. It typically exhibits high thermal stability and low reactivity due to the strong C-F bonds, making it resistant to oxidation and degradation. The presence of multiple fluorine atoms also imparts unique electronic properties, influencing its behavior in various chemical environments. Additionally, decafluorophenanthrene is often studied for its potential applications in materials science, particularly in the development of fluorinated polymers and coatings. Its hydrophobic nature and low surface energy can be advantageous in certain industrial applications. However, the environmental impact and toxicity of highly fluorinated compounds are subjects of ongoing research, as they may persist in the environment and bioaccumulate. Overall, 1,2,3,4,5,6,7,8,9,10-decafluorophenanthrene represents a significant class of compounds in fluorochemistry.
Formula:C14F10
InChI:InChI=1S/C14F10/c15-5-1-2-4(10(20)14(24)12(22)6(2)16)8(18)7(17)3(1)9(19)13(23)11(5)21
SMILES:c12c3c(c(c(c1c(c(c(c2F)F)F)F)F)F)c(c(c(c3F)F)F)F
Synonyms:
  • Phenanthrene, decafluoro-
  • Decafluorophenanthrene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.