CAS 15802-75-2

3-Methyl-4-iodopyrazole

Description:

3-Methyl-4-iodopyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a methyl group at the 3-position and an iodine atom at the 4-position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. Its molecular structure allows for specific interactions with biological targets, making it of interest in medicinal chemistry. The iodine substituent can enhance the compound's reactivity and influence its biological activity. Additionally, 3-Methyl-4-iodopyrazole may exhibit properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 3-Methyl-4-iodopyrazole is a notable compound within the pyrazole class, with diverse applications driven by its chemical characteristics.

Formula: C₄H₅IN₂

InChI: InChI=1/C4H5IN2/c1-3-4(5)2-6-7-3/h2H,1H3,(H,6,7)

SMILES: Cc1c(c[nH]n1)I

Synonyms:

• 4-Iodo-3-methyl-1H-pyrazole
• 4-Lodo-3-Methylpyrazole
• 4-Lodo-3-Methyl Pyrazole
• 4-Iodo-3-Methylpyrazole

1H-Pyrazole, 4-iodo-3-methyl-

CAS: 15802-75-2

Formula: C₄H₅IN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 208.0004

Ref: IN-DA001PWW

4-Iodo-3-methyl-1H-pyrazole

CAS: 15802-75-2

4-Iodo-3-methyl-1H-pyrazole

Formula: C₄H₅IN₂

Purity: 98%

Color and Shape: pale yellow solid

Molecular weight: 208.00g/mol

Ref: 54-OR14994

4-Iodo-3-methyl-1H-pyrazole

CAS: 15802-75-2

Formula: C₄H₅IN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 208.002

Ref: 10-F093372