CAS 15804-78-1
:1-(2,4-DIMETHOXYPHENYL)-2-NITROPROPENE
Description:
1-(2,4-Dimethoxyphenyl)-2-nitropropene is an organic compound characterized by its unique structure, which includes a nitro group and a dimethoxy-substituted phenyl group. This compound typically appears as a yellow to orange crystalline solid and is known for its potential applications in organic synthesis and as an intermediate in the production of various chemical compounds. The presence of the nitro group contributes to its reactivity, making it a useful building block in the synthesis of more complex molecules. Additionally, the dimethoxyphenyl moiety can influence the compound's electronic properties and solubility, affecting its behavior in different chemical environments. As with many nitro compounds, it may exhibit sensitivity to heat and shock, necessitating careful handling and storage. Overall, 1-(2,4-Dimethoxyphenyl)-2-nitropropene is of interest in both academic research and industrial applications, particularly in the fields of medicinal chemistry and materials science.
Formula:C11H13NO4
InChI:InChI=1/C11H13NO4/c1-8(12(13)14)6-9-4-5-10(15-2)7-11(9)16-3/h4-7H,1-3H3/b8-6+
Synonyms:- 1-(2,4-Dimethoxyphenyl)-2-Nitropropene, >95%
- 2,4-dimethoxy-1-[(1E)-2-nitroprop-1-en-1-yl]benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-(2,4-Dimethoxyphenyl)-2-nitropropene
CAS:1-(2,4-Dimethoxyphenyl)-2-nitropropene is a versatile building block that can be used in the synthesis of a wide range of compounds. It is a high quality chemical with a CAS number of 15804-78-1. This compound has been used as an intermediate to synthesize other compounds such as 2-amino-3,5,6-trimethylbenzaldehyde and 1-(2,4-dimethoxyphenyl)-2-(pyrrolidin-1-yl)propene. The compound is also useful as a reagent for reaction components in organic chemistry and biochemistry.
Formula:C11H13NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:223.23 g/mol

