CAS 15806-48-1
:D-Mannitol 1-phosphate
Description:
D-Mannitol 1-phosphate is a phosphorylated derivative of D-mannitol, a sugar alcohol commonly found in plants and fungi. This compound is characterized by the presence of a phosphate group attached to the first carbon of the mannose structure, which influences its biochemical properties and reactivity. D-Mannitol itself is known for its role as a sugar alcohol with applications in food and pharmaceuticals, while its phosphate derivative is significant in metabolic pathways, particularly in the context of carbohydrate metabolism and cellular signaling. The compound is typically a white crystalline solid, soluble in water, and exhibits hygroscopic properties. Its molecular structure allows it to participate in various enzymatic reactions, making it relevant in studies of metabolic processes. Additionally, D-mannitol 1-phosphate may serve as a potential intermediate in the synthesis of other bioactive compounds or as a research tool in biochemical studies. As with many phosphates, it is important to handle it with care due to its potential reactivity and role in biological systems.
Formula:C6H15O9P
InChI:InChI=1S/C6H15O9P/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h3-11H,1-2H2,(H2,12,13,14)/t3-,4-,5-,6-/m1/s1
InChI key:InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-N
SMILES:[C@H]([C@@H]([C@@H](CO)O)O)([C@@H](COP(=O)(O)O)O)O
Synonyms:- 1-O-phosphono-D-mannitol
- <span class="text-smallcaps">D</span>-Mannitol 1-phosphate
- <span class="text-smallcaps">D</span>-Mannitol 6-phosphate
- <span class="text-smallcaps">D</span>-Mannitol, 1-(dihydrogen phosphate)
- Mannitol 1-phosphate
- Mannitol, 1-(dihydrogen phosphate), <span class="text-smallcaps">D</span>-
- Mannitol, 1-phosphate, <span class="text-smallcaps">D</span>-
- D-Mannitol 1-phosphate
- Mannitol, 1-(dihydrogen phosphate), D-
- D-Mannitol, 1-(dihydrogen phosphate)
- Mannitol, 1-phosphate, D-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
D-Mannitol 1-phosphate lithium salt
CAS:<p>D-Mannitol 1-phosphate lithium salt (DMPL) is a bacterial growth-inhibiting agent that inhibits the ribitol dehydrogenase enzyme that converts mannitol to ribitol. The wild-type strain of bacteria is more sensitive to DMPL than the mutant strains, which lack this enzyme. This compound has been shown to be active against Aerobacter aerogenes, and it can be used as an antimicrobial agent in plant physiology, where it prevents cell lysis. DMPL is also effective against wild-type strains of E. coli K-12 and has a broad range of pH optima with a maximum at pH 6.0 to 7.0. The reaction mechanism for this drug is not well understood, but it may involve inhibition of the polymerase chain reaction or other enzyme activities.</p>Formula:C6H15O9P·xLiPurity:Min. 95 Area-%Color and Shape:White Off-White PowderMolecular weight:262.15 g/mol
