CAS 15813-09-9

4,5-Diiodo-1H-imidazole

Description:

4,5-Diiodo-1H-imidazole is a heterocyclic organic compound characterized by the presence of an imidazole ring substituted with two iodine atoms at the 4 and 5 positions. This compound is notable for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the biological activity often associated with halogenated imidazoles. The presence of iodine atoms can enhance the lipophilicity and biological interactions of the molecule. 4,5-Diiodo-1H-imidazole is typically a solid at room temperature and may exhibit varying solubility in organic solvents. Its chemical structure allows for participation in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound's properties, such as melting point, boiling point, and reactivity, can be influenced by the presence of the iodine substituents, which can affect the electronic distribution within the imidazole ring. Overall, 4,5-Diiodo-1H-imidazole is of interest in both synthetic and medicinal chemistry contexts.

Formula: C₃H₂I₂N₂

InChI: InChI=1S/C3H2I2N2/c4-2-3(5)7-1-6-2/h1H,(H,6,7)

InChI key: InChIKey=XMWPTVMTXKJONE-UHFFFAOYSA-N

SMILES: IC1=C(I)N=CN1

Synonyms:

• 1H-Imidazole, 4,5-diiodo-
• 4,5-Diiodo-imidazole
• 4,5-Diiodoimidazole
• Imidazole, 4,5-diiodo-
• 4,5-Diiodo-1H-imidazole

1H-​Imidazole, 4,​5-​diiodo-

CAS: 15813-09-9

Formula: C₃H₂I₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 319.8703

Ref: IN-DA001Q0E

4,5-Diiodo-1H-imidazole

CAS: 15813-09-9

4,5-Diiodo-1H-imidazole

Formula: C₃H₂I₂N₂

Purity: 98%

Color and Shape: off-white solid

Molecular weight: 319.87g/mol

Ref: 54-OR10450

4,5-Diiodo-1H-imidazole

CAS: 15813-09-9

Formula: C₃H₂I₂N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 319.872

Ref: 10-F067398