
CAS 158146-85-1
:4-(3,4-Dimethoxyphenyl)-6,7-dimethoxy-2-(1,2,4-triazol-1-ylmethyl)quinoline-3-carboxylic acid ethyl ester
Description:
4-(3,4-Dimethoxyphenyl)-6,7-dimethoxy-2-(1,2,4-triazol-1-ylmethyl)quinoline-3-carboxylic acid ethyl ester, with CAS number 158146-85-1, is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with various functional groups. This compound features a carboxylic acid ethyl ester moiety, which typically enhances its solubility and bioavailability. The presence of methoxy groups on the phenyl and quinoline rings suggests potential for increased lipophilicity and may influence its biological activity. The triazole ring is known for its role in medicinal chemistry, often contributing to antifungal and antimicrobial properties. The compound's structure indicates potential applications in pharmaceuticals, particularly in the development of therapeutic agents. Its specific interactions and reactivity would depend on the functional groups present, making it a candidate for further investigation in drug design and development. As with many complex organic compounds, its stability, solubility, and reactivity would be influenced by environmental conditions and the presence of other chemical species.
Formula:C25H26N4O6
InChI:InChI=1/C25H26N4O6/c1-6-35-25(30)24-18(12-29-14-26-13-27-29)28-17-11-22(34-5)21(33-4)10-16(17)23(24)15-7-8-19(31-2)20(9-15)32-3/h7-11,13-14H,6,12H2,1-5H3
Synonyms:- TAK-603
- ethyl 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-(1H-1,2,4-triazol-1-ylmethyl)quinoline-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
TAK-603
CAS:TAK-603: anti-rheumatic, anti-inflammatory drug; selectively halts Th1 cytokine production, prevents adjuvant arthritis progression.Formula:C25H26N4O6Color and Shape:SolidMolecular weight:478.5
