CAS 158171-14-3
:Fmoc-O-(benzylphospho)-L-serine
Description:
Fmoc-O-(benzylphospho)-L-serine is a phosphoamino acid derivative commonly used in peptide synthesis and bioconjugation. It features a phenylmethoxycarbonyl (Fmoc) protecting group, which is widely utilized for the protection of amino groups during peptide synthesis. The presence of a benzylphosphoryl group indicates that it contains a phosphonic acid moiety, which can play a crucial role in biological signaling and interactions. This compound is characterized by its ability to participate in various chemical reactions, including phosphorylation and coupling reactions, making it valuable in the development of phosphopeptides. Its structure allows for the introduction of phosphoserine residues into peptides, which can mimic post-translational modifications found in proteins. The compound is typically soluble in organic solvents and may exhibit specific reactivity patterns due to the presence of both the phospho and amino acid functionalities. Overall, Fmoc-O-(benzylphospho)-L-serine serves as an important tool in synthetic organic chemistry and biochemistry for studying protein function and interactions.
Formula:C25H24NO8P
InChI:InChI=1/C25H24NO8P/c27-24(28)23(16-34-35(30,31)33-14-17-8-2-1-3-9-17)26-25(29)32-15-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h1-13,22-23H,14-16H2,(H,26,29)(H,27,28)(H,30,31)/t23-/m0/s1
InChI key:ZBPUWGDUVAAWJY-QHCPKHFHSA-N
SMILES:c1ccc(cc1)COP(=O)(O)OC[C@@H](C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12
Synonyms:- Fmoc-L-Ser(Po(Obzl)Oh)
- Fmoc-L-Ser(Po(Obzl)Oh)-Oh
- Fmoc-L-Phosphoserine
- Fmoc-O-Benzyl-L-Phosphoserine
- Fmoc-Ser(Po(Obzl)Oh)-Oh
- Fmoc-Ser(HPO3Bzl)-OH
- Fmoc-Serine(Po(Obzl)Oh)-Oh
- O-[(benzyloxy)(hydroxy)phosphoryl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-serine
- Fmoc-Ser(PO(OBzl))-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
O-Benzylphospho-N-Fmoc-L-serine, 95%
CAS:It can be applied in the synthesis of phosphopeptides. This derivative can be introduced using standard activation methods, such as PyBOP and TBTU. The monoprotected phosphoserine residue once incorporated is stable to piperidine. Using this reagent, even peptides containing multiple phosphorylationFormula:C25H24NO8PPurity:95%Molecular weight:497.44Fmoc-Ser(PO(OBzl)OH)-OH
CAS:Building block for the synthesis of phosphoserine-containing peptides. Harris et al. observed a considerable extent of S-benzylation of adjacent Met residues during microwave-assisted TFA cleavage. Attard et al. recommend the use of cyclohexylamine/DCM (1:1) for Fmoc removal to minimize concomitant β-elimination.Formula:C25H24NO8PPurity:97.96%Color and Shape:White PowderMolecular weight:497.44Fmoc-O-(Benzylphospho)-L-Serine
CAS:Fmoc-O-(Benzylphospho)-L-SerineFormula:C25H24NO8PPurity:98%Color and Shape:SolidMolecular weight:497.43Fmoc-Ser(PO3BzlH)-OH
CAS:Formula:C25H24NO8PPurity:≥ 97.0%Color and Shape:Off-white powderMolecular weight:497.44Fmoc-O-benzylphospho-L-serine
CAS:Fmoc-O-benzylphospho-L-serine is a fmoc-protected phosphoserine derivative for efficient synthesis of phosphoserine-containing peptides via standard fmoc SPPS. Compatible with common activators such as PyBOP or TBTU, it remains stable during piperidine deprotection and enables incorporation of multiple phosphoserine residues, for example successful syntheses of phospholamban and human salivary statherin. In certain cases, β-piperidinylalanine formation may occur during N-terminal Ser(PO(OBzl)OH) Fmoc deprotection, especially under microwave conditions.Formula:C25H24NO8PPurity:Min. 97 Area-%Color and Shape:White Off-White PowderMolecular weight:497.43 g/molFmoc-Ser(HPO3Bzl)-OH
CAS:M03387 - Fmoc-Ser(HPO3Bzl)-OH
Formula:C25H24NO8PPurity:95%Color and Shape:SolidMolecular weight:497.44







