CymitQuimica logo

CAS 158181-84-1

:

1-(5-Methyl-2-pyridinyl)-4-piperidinol

Description:
1-(5-Methyl-2-pyridinyl)-4-piperidinol, with the CAS number 158181-84-1, is a chemical compound characterized by its unique structure, which includes a piperidinyl group and a pyridine ring substituted with a methyl group. This compound typically exhibits properties associated with both heterocyclic amines and alcohols, making it of interest in various chemical and pharmaceutical applications. It is often studied for its potential biological activities, including effects on the central nervous system, due to the presence of the piperidine moiety. The compound is likely to be soluble in polar solvents, reflecting the presence of the hydroxyl group, while its aromatic pyridine component may contribute to its stability and reactivity. Additionally, the methyl substitution on the pyridine ring can influence its electronic properties and steric hindrance, affecting its interactions with biological targets. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.
Formula:C11H16N2O
InChI:InChI=1/C11H16N2O/c1-9-2-3-11(12-8-9)13-6-4-10(14)5-7-13/h2-3,8,10,14H,4-7H2,1H3
InChI key:JBQHLVDKECTGIC-UHFFFAOYSA-N
SMILES:Cc1ccc(nc1)N1CCC(CC1)O
Found 2 products.