CAS 158196-35-1
:Naringenin-4′-O-glucuronide
Description:
Naringenin-4′-O-glucuronide is a flavonoid glycoside, specifically a glucuronide derivative of naringenin, which is a naturally occurring flavonoid found in various citrus fruits. This compound is characterized by its structure, which includes a naringenin backbone linked to a glucuronic acid moiety at the 4′ position. It exhibits various biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. Naringenin-4′-O-glucuronide is soluble in water due to the presence of the glucuronic acid group, which enhances its bioavailability. It is often studied for its role in the metabolism of flavonoids and their effects on human health. The compound is typically analyzed using techniques such as high-performance liquid chromatography (HPLC) and mass spectrometry to determine its concentration and purity in various samples. Overall, Naringenin-4′-O-glucuronide represents a significant area of study in the field of natural products and their therapeutic potential.
Formula:C21H20O11
InChI:InChI=1S/C21H20O11/c22-9-5-11(23)15-12(24)7-13(31-14(15)6-9)8-1-3-10(4-2-8)30-21-18(27)16(25)17(26)19(32-21)20(28)29/h1-6,13,16-19,21-23,25-27H,7H2,(H,28,29)/t13-,16-,17-,18+,19-,21+/m0/s1
InChI key:InChIKey=DFIUUCDSSKATFP-CGXGPNJMSA-N
SMILES:O=C1C=2C(O[C@@H](C1)C3=CC=C(O[C@@H]4O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]4O)C=C3)=CC(O)=CC2O
Synonyms:- β-D-Glucopyranosiduronic acid, 4-(3,4-dihydro-5,7-dihydroxy-4-oxo-2H-1-benzopyran-2-yl)phenyl, (S)-
- β-D-Glucopyranosiduronic acid, 4-[(2S)-3,4-dihydro-5,7-dihydroxy-4-oxo-2H-1-benzopyran-2-yl]phenyl
- Naringenin-4′-O-β-D-glucuronopyranoside
- 4-[(2S)-3,4-Dihydro-5,7-dihydroxy-4-oxo-2H-1-benzopyran-2-yl]phenyl β-D-glucopyranosiduronic acid
- Naringenin-4′-O-glucuronide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Naringenin 4’-O-β-D-Glucuronide(Mixture of Diastereomers)
CAS:Formula:C21H20O11Molecular weight:448.38
