CAS 1582-05-4

2-Pentafluorophenyl-malonic acid diethyl ester

Description:

2-Pentafluorophenyl-malonic acid diethyl ester, with the CAS number 1582-05-4, is an organic compound characterized by its structure, which includes a malonic acid core esterified with diethyl groups and substituted with a pentafluorophenyl group. This compound typically exhibits a high degree of fluorination, which imparts unique properties such as increased lipophilicity and altered reactivity compared to non-fluorinated analogs. The presence of the pentafluorophenyl group enhances its electron-withdrawing characteristics, making it useful in various chemical reactions, particularly in the synthesis of more complex fluorinated compounds. Additionally, the diethyl ester functionality contributes to its solubility in organic solvents, facilitating its application in organic synthesis and medicinal chemistry. The compound may also exhibit interesting biological activities due to its structural features, making it a subject of interest in pharmaceutical research. Overall, 2-Pentafluorophenyl-malonic acid diethyl ester is notable for its unique fluorinated structure and potential applications in various chemical fields.

Formula: C₁₃H₁₁F₅O₄

InChI: InChI=1/C13H11F5O4/c1-3-21-12(19)6(13(20)22-4-2)5-7(14)9(16)11(18)10(17)8(5)15/h6H,3-4H2,1-2H3

SMILES: CCOC(=O)C(c1c(c(c(c(c1F)F)F)F)F)C(=O)OCC

Synonyms:

• Diethyl (Pentafluorophenyl)Propanedioate

Sitagliptin Impurity 56

CAS: 1582-05-4

Formula: C₁₃H₁₁F₅O₄

Molecular weight: 326.22

Ref: 4Z-S-2091