CAS 1582-05-4
:2-Pentafluorophenyl-malonic acid diethyl ester
Description:
2-Pentafluorophenyl-malonic acid diethyl ester, with the CAS number 1582-05-4, is an organic compound characterized by its structure, which includes a malonic acid core esterified with diethyl groups and substituted with a pentafluorophenyl group. This compound typically exhibits a high degree of fluorination, which imparts unique properties such as increased lipophilicity and altered reactivity compared to non-fluorinated analogs. The presence of the pentafluorophenyl group enhances its electron-withdrawing characteristics, making it useful in various chemical reactions, particularly in the synthesis of more complex fluorinated compounds. Additionally, the diethyl ester functionality contributes to its solubility in organic solvents, facilitating its application in organic synthesis and medicinal chemistry. The compound may also exhibit interesting biological activities due to its structural features, making it a subject of interest in pharmaceutical research. Overall, 2-Pentafluorophenyl-malonic acid diethyl ester is notable for its unique fluorinated structure and potential applications in various chemical fields.
Formula:C13H11F5O4
InChI:InChI=1/C13H11F5O4/c1-3-21-12(19)6(13(20)22-4-2)5-7(14)9(16)11(18)10(17)8(5)15/h6H,3-4H2,1-2H3
SMILES:CCOC(=O)C(c1c(c(c(c(c1F)F)F)F)F)C(=O)OCC
Synonyms:- Diethyl (Pentafluorophenyl)Propanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
