CAS 1582-24-7
:2,3,4,5,6-Pentafluorobenzeneboronic acid
Description:
2,3,4,5,6-Pentafluorobenzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a benzene ring that is fully substituted with fluorine atoms at the 2, 3, 4, 5, and 6 positions. This unique substitution pattern imparts significant chemical properties, including high reactivity and polarity, making it useful in various synthetic applications, particularly in the field of organic chemistry and materials science. The presence of the boronic acid group allows for participation in Suzuki coupling reactions, facilitating the formation of carbon-carbon bonds. Additionally, the fluorinated benzene ring enhances the compound's stability and solubility in polar solvents. Its high electronegativity due to fluorine substitution can also influence its interaction with other chemical species, making it a valuable reagent in the development of pharmaceuticals and agrochemicals. Safety considerations should be taken into account when handling this compound, as boronic acids can be sensitive to moisture and may require specific storage conditions.
Formula:C6H2BF5O2
InChI:InChI=1/C6H2BF5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h13-14H
SMILES:c1(c(c(c(c(c1F)F)F)F)F)B(O)O
Synonyms:- 2,3,4,5,6-Pentafluorophenylboronic acid
- Pentafluorophenylboronic acid
- (Pentafluorophenyl)Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Pentafluorophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H2BF5O2Purity:97.0 to 110.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:211.88Boronic acid, B-(2,3,4,5,6-pentafluorophenyl)-
CAS:Formula:C6H2BF5O2Purity:98%Color and Shape:SolidMolecular weight:211.88192,3,4,5,6-Pentafluorophenylboronic acid
CAS:Formula:C6H2BF5O2Purity:≥ 98.0%Color and Shape:White to off-white or beige powderMolecular weight:211.88Pentafluorobenzeneboronic acid
CAS:Pentafluorobenzeneboronic acidFormula:C6H2BF5O2Purity:97%Color and Shape: white solidMolecular weight:211.88g/mol2,3,4,5,6-Pentafluorobenzeneboronic acid
CAS:Formula:C6H2BF5O2Purity:95%Color and Shape:SolidMolecular weight:211.88Pentafluorobenzeneboronic acid
CAS:Pentafluorobenzeneboronic acid is a boronic acid that is used in the synthesis of cationic polymers for use as an environmentally friendly alternative to perfluoroalkyl compounds. Pentafluorobenzeneboronic acid can be synthesized by the reaction of hydrochloric acid and pentafluorophenol. The energy efficiency of this molecule is low, which makes it an attractive candidate for use in polymer synthesis. Pentafluorobenzeneboronic acid reacts with nucleophiles at its α carbon to form a covalent linkage, which is reversible under certain conditions. This chemical has been shown to react with β-unsaturated ketones and trifluoroacetic acid to form polyenes with control experiments being done by adding ammonia gas or water to the reaction mixture.Formula:C6H2BF5O2Purity:Min. 95%Color and Shape:SolidMolecular weight:211.88 g/mol





