CymitQuimica logo

CAS 1582770-06-6

:

Ethanone, 1-[2-[[3-(trifluoromethyl)phenyl]amino]-5-thiazolyl]-

Description:
Ethanone, 1-[2-[[3-(trifluoromethyl)phenyl]amino]-5-thiazolyl]- is a chemical compound characterized by its complex structure, which includes an ethanone moiety and a thiazole ring substituted with a trifluoromethylphenyl amino group. This compound is likely to exhibit properties typical of both thiazole and aromatic systems, such as potential biological activity and stability under various conditions. The presence of the trifluoromethyl group may enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. Additionally, thiazole derivatives are often associated with pharmacological properties, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific biological pathways. However, detailed studies would be necessary to fully understand its properties, including solubility, melting point, and reactivity, as well as its safety profile and potential environmental impact.
Formula:C12H9F3N2OS
InChI:InChI=1S/C12H9F3N2OS/c1-7(18)10-6-16-11(19-10)17-9-4-2-3-8(5-9)12(13,14)15/h2-6H,1H3,(H,16,17)
InChI key:InChIKey=KOCRCILBFBMWHS-UHFFFAOYSA-N
SMILES:N(C=1SC(C(C)=O)=CN1)C2=CC(C(F)(F)F)=CC=C2
Synonyms:
  • 1-[2-[[3-(Trifluoromethyl)phenyl]amino]-5-thiazolyl]ethanone
  • Ethanone, 1-[2-[[3-(trifluoromethyl)phenyl]amino]-5-thiazolyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.