CAS 1582770-07-7
:2-Oxo-2-phenylethyl 3-[(4-chlorophenyl)amino]-3-oxopropanoate
Description:
2-Oxo-2-phenylethyl 3-[(4-chlorophenyl)amino]-3-oxopropanoate is a chemical compound characterized by its complex structure, which includes a phenyl group, a chlorophenyl substituent, and multiple carbonyl functionalities. This compound features a ketone and an ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the 4-chlorophenylamino group suggests that it may exhibit biological activity, potentially making it of interest in pharmaceutical research. The molecular structure indicates that it could participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions, due to the electrophilic nature of the carbonyl groups. Additionally, the compound's solubility and stability may vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, this compound represents a class of organic molecules that may have significant implications in medicinal chemistry and material science.
Formula:C17H14ClNO4
InChI:InChI=1S/C17H14ClNO4/c18-13-6-8-14(9-7-13)19-16(21)10-17(22)23-11-15(20)12-4-2-1-3-5-12/h1-9H,10-11H2,(H,19,21)
InChI key:InChIKey=JQAQSENSMRAEJB-UHFFFAOYSA-N
SMILES:N(C(CC(OCC(=O)C1=CC=CC=C1)=O)=O)C2=CC=C(Cl)C=C2
Synonyms:- 2-Oxo-2-phenylethyl 2-[(4-chlorophenyl)carbamoyl]acetate
- Propanoic acid, 3-[(4-chlorophenyl)amino]-3-oxo-, 2-oxo-2-phenylethyl ester
- Phenacyl 3-[(4-chlorophenyl)amino]-3-oxopropanoate
- 2-Oxo-2-phenylethyl 3-[(4-chlorophenyl)amino]-3-oxopropanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Oxo-2-phenylethyl 2-[(4-chlorophenyl)carbamoyl]acetate
CAS:<p>2-Oxo-2-phenylethyl 2-[(4-chlorophenyl)carbamoyl]acetate</p>Molecular weight:331.75g/mol
