CAS 15828-63-4

5-METHYL-6-AMINOURACIL

Description:

5-Methyl-6-aminouracil is a pyrimidine derivative characterized by the presence of a methyl group and an amino group on the uracil structure. This compound features a six-membered ring containing nitrogen atoms, which contributes to its biological activity. It is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohol, reflecting its polar functional groups. The presence of the amino group suggests potential for hydrogen bonding, which can influence its interactions in biological systems. 5-Methyl-6-aminouracil is of interest in medicinal chemistry, particularly for its potential role in nucleic acid metabolism and as a precursor in the synthesis of various pharmaceuticals. Its chemical reactivity may include participation in substitution reactions, and it may exhibit biological activities such as antimicrobial or antiviral properties. As with many nitrogen-containing heterocycles, it may also play a role in enzyme inhibition or modulation, making it a compound of interest in drug development and biochemical research.

Formula: C₅H₇N₃O₂

InChI: InChI=1/C5H7N3O2/c1-2-3(6)7-5(10)8-4(2)9/h1H3,(H4,6,7,8,9,10)

SMILES: Cc1c(N)nc(nc1O)O

Synonyms:

• 6-Aminothymine
• 2,4(1H,3H)-Pyrimidinedione, 6-amino-5-methyl- (9CI)
• 6-amino-5-methylpyrimidine-2,4(1H,3H)-dione

6-Amino-5-methylpyrimidine-2,4(1H,3H)-dione

CAS: 15828-63-4

Formula: C₅H₇N₃O₂

Molecular weight: 141.128

Ref: IN-DA001Q3F

6-Aminothymine

CAS: 15828-63-4

6-Aminothymine is a polyamine that exerts its inhibitory activity by hydrogen bonding to the enzyme's active site. It has been shown to inhibit protein synthesis and growth factor synthesis in HL-60 cells. 6-Aminothymine also has cancer inhibiting properties, which may be due to its ability to bind DNA and interfere with replication or transcription.

Formula: C₅H₇N₃O₂

Purity: Min. 95%

Molecular weight: 141.13 g/mol

Ref: 3D-NA159265