CymitQuimica logo

CAS 1583-65-9

:

2-fluoroisophthalic acid

Description:
2-Fluoroisophthalic acid is an aromatic carboxylic acid characterized by the presence of a fluorine atom and two carboxylic acid groups attached to a benzene ring. Its molecular structure features a fluorine substituent at the 2-position relative to the carboxylic acid groups, which are located at the 1 and 3 positions, making it a derivative of isophthalic acid. This compound is typically a white to off-white solid and is soluble in polar organic solvents. It exhibits properties typical of carboxylic acids, such as the ability to form hydrogen bonds, which can influence its reactivity and interactions with other molecules. The presence of the fluorine atom can enhance its acidity and alter its electronic properties, making it useful in various chemical applications, including as a building block in the synthesis of polymers, pharmaceuticals, and agrochemicals. Additionally, its unique structure may impart specific characteristics that can be exploited in material science and organic synthesis.
Formula:C8H5FO4
InChI:InChI=1S/C8H5FO4/c9-6-4(7(10)11)2-1-3-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13)
InChI key:DWOLBEJAJWCIGK-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1)C(=O)O)F)C(=O)O
Synonyms:
  • 2-Fluorobenzene-1,3-dicarboxylic acid
Found 5 products.