CAS 158364-59-1
:methyl (2-{[(2,3-dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl}-3-methylphenyl)carbamate
Description:
Methyl (2-{[(2,3-dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl}-3-methylphenyl)carbamate, identified by its CAS number 158364-59-1, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and an imidazo[1,2-a]pyridine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the dimethylimidazo group suggests possible interactions with biological systems, making it of interest in medicinal chemistry and pharmacology. Its molecular structure indicates that it may possess lipophilic characteristics, which can influence its solubility and permeability in biological membranes. Additionally, the presence of multiple functional groups may allow for various chemical reactions, making it a versatile compound in synthetic chemistry. Overall, this compound's unique structural features and potential reactivity highlight its significance in research and development within the fields of organic and medicinal chemistry.
Formula:C19H22N4O2
InChI:InChI=1/C19H22N4O2/c1-12-7-5-8-16(22-19(24)25-4)15(12)11-20-17-9-6-10-23-14(3)13(2)21-18(17)23/h5-10,20H,11H2,1-4H3,(H,22,24)
SMILES:Cc1cccc(c1CNc1cccn2c(C)c(C)nc12)N=C(O)OC
Synonyms:- Methyl 2-[[(2,3-Dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylcarbanilate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Pumaprazole
CAS:Pumaprazole is a proton pump inhibitor that is used to treat the symptoms of migraine. It has been found to be clinically effective in treating the symptoms of migraine and is a reversible, oral agent with pharmacokinetic properties similar to those of rizatriptan. Pumaprazole inhibits gastric acid secretion by binding to the H+/K+-ATPase enzyme at the secretory canaliculus, which results in an increase in pH and decreased acidity within the stomach. Pumaprazole also inhibits serotonin 5-HT4 receptors and is being developed for use as an antiemetic.
Formula:C19H22N4O2Purity:Min. 95%Molecular weight:338.4 g/molPumaprazole
CAS:Pumaprazole (BY-841) is an antagonist of a reversible proton pump.Formula:C19H22N4O2Purity:99.91%Color and Shape:SolidMolecular weight:338.4Ref: TM-T16682
1mg87.00€5mg178.00€1mL*10mM (DMSO)203.00€10mg295.00€25mg602.00€50mg964.00€100mg1,558.00€200mg2,097.00€


