CAS 15837-08-8
:3,9-Dimethylxanthine
Description:
3,9-Dimethylxanthine, with the CAS number 15837-08-8, is a methylated derivative of xanthine, a purine base found in various biological systems. This compound is characterized by the presence of two methyl groups attached to the xanthine structure, specifically at the 3 and 9 positions. It is a white to off-white crystalline powder that is soluble in water and organic solvents, reflecting its polar nature due to the presence of nitrogen atoms in its structure. 3,9-Dimethylxanthine exhibits biological activity, primarily as a stimulant, and is related to other xanthine derivatives like caffeine and theobromine. It is often studied for its potential effects on the central nervous system and its role in various physiological processes. Additionally, this compound may be involved in research related to pharmacology and biochemistry, particularly in understanding its interactions with adenosine receptors. As with many xanthine derivatives, it may also have implications in the fields of nutrition and health.
Formula:C7H8N4O2
InChI:InChI=1S/C7H8N4O2/c1-10-3-8-4-5(12)9-7(13)11(2)6(4)10/h3H,1-2H3,(H,9,12,13)
InChI key:InChIKey=HEOWZFHIJSYJIC-UHFFFAOYSA-N
SMILES:CN1C2=C(C(=O)NC1=O)N=CN2C
Synonyms:- 1H-Purine-2,6-dione, 3,9-dihydro-3,9-dimethyl-
- 3,9-Dihydro-3,9-dimethyl-1H-purine-2,6-dione
- 3,9-Dimethyl-1H-purine-2,6(3H,9H)-dione
- 3,9-dimethyl-3,9-dihydro-1H-purine-2,6-dione
- Xanthine, 3,9-dimethyl-
- 3,9-Dimethylxanthine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.


