CAS 158401-00-4

2,2,2-Trifluoro-1-(3,4,5-trichlorophenyl)ethanone

Description:

2,2,2-Trifluoro-1-(3,4,5-trichlorophenyl)ethanone, with the CAS number 158401-00-4, is a synthetic organic compound characterized by its unique molecular structure, which includes a trifluoroethyl group and a trichlorophenyl moiety. This compound is typically a solid at room temperature and exhibits a high degree of lipophilicity due to the presence of multiple halogen atoms, which can influence its solubility and reactivity. The trifluoromethyl group contributes to its stability and can enhance its biological activity, making it of interest in various fields, including agrochemicals and pharmaceuticals. The presence of the trichlorophenyl group may impart specific electronic properties, affecting its interaction with biological targets. Additionally, the compound may exhibit significant environmental persistence due to its halogenated structure, raising considerations for its ecological impact. Overall, 2,2,2-Trifluoro-1-(3,4,5-trichlorophenyl)ethanone is notable for its complex halogenated structure, which plays a crucial role in its chemical behavior and potential applications.

Formula: C₈H₂Cl₃F₃O

InChI: InChI=1S/C8H2Cl3F3O/c9-4-1-3(2-5(10)6(4)11)7(15)8(12,13)14/h1-2H

SMILES: c1c(cc(c(c1Cl)Cl)Cl)C(=O)C(F)(F)F

Synonyms:

• Ethanone, 2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)-

Ethanone, 2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)-

CAS: 158401-00-4

Formula: C₈H₂Cl₃F₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 277.4551

Ref: IN-DA001Q65

2,2,2-Trifluoro-1-(3,4,5-trichlorophenyl)ethanone

CAS: 158401-00-4

2,2,2-Trifluoro-1-(3,4,5-trichlorophenyl)ethanone

Purity: 97%

Molecular weight: 277.46g/mol

Ref: 54-PC99807

2,2,2-Trifluoro-1-(3,4,5-trichlorophenyl)ethanone

CAS: 158401-00-4

Formula: C₈H₂Cl₃F₃O

Purity: 98%

Color and Shape: No data available.

Molecular weight: 277.45

Ref: 10-F334534