CAS 158407-04-6
:4-Bromomethyl-Piperidine-1-Carboxylic Acid Tert-Butyl Ester
Description:
4-Bromomethyl-Piperidine-1-Carboxylic Acid Tert-Butyl Ester is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of a bromomethyl group indicates a bromine atom attached to a methylene group adjacent to the piperidine nitrogen, enhancing its reactivity and potential for further chemical modifications. The tert-butyl ester functional group suggests that the carboxylic acid moiety is esterified with a tert-butyl group, which can influence the compound's solubility and stability. This compound is typically used in organic synthesis and medicinal chemistry, often serving as an intermediate in the preparation of more complex molecules. Its properties, such as boiling point, melting point, and solubility, can vary based on the specific conditions and the presence of other functional groups. Safety data should be consulted for handling, as the bromine atom can impart toxicity and reactivity. Overall, this compound exemplifies the diverse functionalities that can be incorporated into piperidine derivatives for various applications in chemical research and development.
Formula:C11H20BrNO2
InChI:InChI=1/C11H20BrNO2/c1-11(2,3)15-10(14)13-6-4-9(8-12)5-7-13/h9H,4-8H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)CBr
Synonyms:- 1-N-Boc-4-Bromomethylpiperidine
- 1-Boc-4-Bromomethylpiperidine
- 4-Bromomethyl-Piperidine-1-Carboxylic Acid Tert-Butyk Ester
- N-Boc-4-Bromomethyl-Piperidine
- Tert-Butyl4-(Bromoethyl)Piperidine-1-Carboxylate
- Tert-Butyl 4-(Bromomethyl)Piperidine-1-Carboxylate
- 4-BROMOMETHYL-PIPERIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER
- 4-Bromomethyl-1-(tert-butoxycarbonyl)piperidine
- 1-Boc-4-(bromoMmethyl)piperidine
- 1-Boc-4-BromomethyL
- 1-Boc-4-broMoMethylpiperi...
- 4-Bromomethylpiperidine-1-carboxylic acid tert-butyl ester 95%
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Piperidinecarboxylic acid, 4-(bromomethyl)-, 1,1-dimethylethyl ester
CAS:Formula:C11H20BrNO2Purity:97%Color and Shape:SolidMolecular weight:278.1860Ref: IN-DA001Q62
1g25.00€5g40.00€10g60.00€1kgTo inquire25g101.00€5kgTo inquire100g203.00€500gTo inquire250mgTo inquiretert-Butyl 4-(bromomethyl)piperidine-1-carboxylate
CAS:tert-Butyl 4-(bromomethyl)piperidine-1-carboxylatePurity:98%Color and Shape:SolidMolecular weight:278.19g/moltert-Butyl 4-(Bromomethyl)piperidine-1-carboxylate
CAS:Formula:C11H20BrNO2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:278.191-Boc-4-bromomethylpiperidine
CAS:1-Boc-4-bromomethylpiperidine is a versatile building block for the synthesis of complex compounds with diverse biological activity. It is an excellent reagent for the synthesis of 1,2,3-triazoles, which are useful scaffolds in the synthesis of high quality pharmaceuticals. This compound can be used as a reaction component and as a useful intermediate in various chemical reactions.Formula:C11H20BrNO2Purity:Min. 97 Area-%Color and Shape:PowderMolecular weight:278.19 g/molN-Boc-4-Bromomethyl-piperidine
CAS:Formula:C11H20BrNO2Purity:97%Color and Shape:Chunks,Crystalline PowderMolecular weight:278.19




