CymitQuimica logo

CAS 158465-54-4

:

Poly[oxy(dimethylsilylene)],a-[bis(acetyloxy)methylsilyl]-w-[[bis(acetyloxy)methylsilyl]oxy]-

Description:
Poly[oxy(dimethylsilylene)], a-[bis(acetyloxy)methylsilyl]-w-[[bis(acetyloxy)methylsilyl]oxy]- is a siloxane-based polymer characterized by its unique structure that incorporates both siloxane and acetyloxy functional groups. This polymer exhibits properties typical of siloxanes, such as flexibility, thermal stability, and resistance to moisture and chemicals. The presence of acetyloxy groups enhances its reactivity, allowing for potential applications in various fields, including coatings, adhesives, and sealants. The polymer's molecular architecture contributes to its ability to form films and its compatibility with other materials. Additionally, the presence of multiple functional groups can facilitate further chemical modifications, making it versatile for specialized applications. Its synthesis typically involves the polymerization of siloxane monomers, followed by functionalization with acetyloxy groups. Overall, this substance is notable for its balance of mechanical properties and chemical reactivity, making it suitable for advanced material applications in industries such as electronics, automotive, and biomedical engineering.
Formula:(C2H6OSi)nC10H18O9Si2
Synonyms:
  • Dimethylsilanediolhomopolymer, diacetoxymethylsilyl-terminated sru
  • Ps 368.5
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.