CAS 158511-59-2
:Eclalbasaponin I
Description:
Eclalbasaponin I is a triterpenoid saponin, a class of compounds known for their surface-active properties and potential biological activities. It is derived from the plant species Eclalbasopsis stellatifolia, which is found in certain tropical regions. This compound typically exhibits a complex structure characterized by a steroid-like backbone with sugar moieties attached, contributing to its solubility and interaction with biological membranes. Eclalbasaponin I has garnered interest in pharmacological research due to its potential anti-inflammatory, antimicrobial, and cytotoxic properties. Additionally, like many saponins, it may have the ability to form micelles, which can enhance the bioavailability of other compounds when used in formulations. Its unique structural features and biological activities make it a subject of interest in natural product chemistry and drug development. However, further studies are necessary to fully elucidate its mechanisms of action and potential therapeutic applications.
Formula:C42H68O14
InChI:InChI=1S/C42H68O14/c1-37(2)14-15-42(36(52)56-35-33(51)31(49)29(47)23(19-44)54-35)21(16-37)20-8-9-25-39(5)12-11-27(55-34-32(50)30(48)28(46)22(18-43)53-34)38(3,4)24(39)10-13-40(25,6)41(20,7)17-26(42)45/h8,21-35,43-51H,9-19H2,1-7H3/t21-,22+,23+,24-,25+,26+,27-,28+,29+,30-,31-,32+,33+,34-,35-,39-,40+,41+,42+/m0/s1
InChI key:InChIKey=ZKMRZIYTCZLEAV-VVJIWJAZSA-N
SMILES:C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)(=O)[C@]23[C@](C=4[C@@](C)(C[C@H]2O)[C@@]5(C)[C@](CC4)([C@]6(C)[C@@](CC5)(C(C)(C)[C@@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)CC6)[H])[H])(CC(C)(C)CC3)[H]
Synonyms:- (+)-EclalbasaponinI
- Eclalbasaponin I
- Olean-12-en-28-oic acid, 3-(β-<span class="text-smallcaps">D</smallcap>-glucopyranosyloxy)-16-hydroxy-, β-<smallcap>D</span>-glucopyranosyl ester, (3β,16α)-
- Olean-12-en-28-oic acid, 3-(β-D-glucopyranosyloxy)-16-hydroxy-, β-D-glucopyranosyl ester, (3β,16α)-
- Eclalbasaponin C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Eclalbasaponin I
CAS:Eclalbasaponin I: antioxidant, antitumor, protects neural cells via autophagy, inhibits hepatoma SMMC-7721 (IC50=111.1703 ug/ml).Formula:C42H68O14Purity:98.75% - 99.90%Color and Shape:SolidMolecular weight:796.98Eclalbasaponin i
CAS:Natural glycosideFormula:C42H68O14Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:797Eclalbasaponin I
CAS:Eclalbasaponin I is a triterpenoid saponin, which is a type of natural glycoside compound. It is derived from plants of the Euphorbia genus, known for their rich content of bioactive phytochemicals. The mode of action of Eclalbasaponin I involves modulating cellular pathways through its interactions with membrane proteins and lipid structures, influencing cellular functions and eliciting various biological activities.
Formula:C42H68O14Purity:Min. 95%Molecular weight:796.98 g/mol





