CAS 158511-60-5

Eclalbasaponin III

Description:

Eclalbasaponin III is a triterpenoid saponin, a class of compounds known for their surface-active properties and potential biological activities. It is derived from the plant Eclalbasopetalum, which is part of the family Annonaceae. This compound is characterized by its complex glycosidic structure, which typically includes a hydrophobic aglycone and one or more sugar moieties. Eclalbasaponin III exhibits various pharmacological properties, including anti-inflammatory, antimicrobial, and cytotoxic activities, making it of interest in medicinal chemistry and pharmacology. Its unique structure contributes to its ability to interact with biological membranes, potentially influencing cell signaling and membrane permeability. Additionally, saponins like Eclalbasaponin III are known to exhibit foaming properties, which can be utilized in various industrial applications, including cosmetics and food products. As research continues, the full range of its biological effects and potential therapeutic applications is still being explored.

Formula: C₄₈H₇₈O₁₉

InChI: InChI=1S/C48H78O19/c1-43(2)14-15-48(42(61)67-40-37(60)34(57)31(54)24(19-50)63-40)22(16-43)21-8-9-27-45(5)12-11-29(44(3,4)26(45)10-13-46(27,6)47(21,7)17-28(48)52)65-41-38(35(58)32(55)25(20-51)64-41)66-39-36(59)33(56)30(53)23(18-49)62-39/h8,22-41,49-60H,9-20H2,1-7H3/t22-,23+,24+,25+,26-,27+,28+,29-,30+,31+,32+,33-,34-,35-,36+,37+,38+,39-,40-,41-,45-,46+,47+,48+/m0/s1

InChI key: InChIKey=VDLZBNZYXLJBRB-XMJBUMATSA-N

SMILES: C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)(=O)[C@]23[C@](C=4[C@@](C)(C[C@H]2O)[C@@]5(C)[C@](CC4)([C@]6(C)[C@@](CC5)(C(C)(C)[C@@H](O[C@H]7[C@H](O[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)[C@@H](O)[C@H](O)[C@@H](CO)O7)CC6)[H])[H])(CC(C)(C)CC3)[H]

Synonyms:

• (-)-Eclalbasaponin III
• Eclalbasaponin III
• Olean-12-en-28-oic acid, 3-[(2-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-16-hydroxy-, β-D-glucopyranosyl ester, (3β,16α)-

Eclalbasaponin III

CAS: 158511-60-5

Eclalbasaponin III is a useful organic compound for research related to life sciences. The catalog number is T125712 and the CAS number is 158511-60-5.

Formula: C₄₈H₇₈O₁₉

Color and Shape: Solid

Molecular weight: 959.133

Ref: TM-T125712