CAS 158511-72-9
:1-(3,4-dimethylphenyl)-3-phenyl-propan-1-one
Description:
1-(3,4-Dimethylphenyl)-3-phenyl-propan-1-one, also known as benzyl methyl ketone, is an organic compound characterized by its ketone functional group and a complex aromatic structure. It features a propan-1-one backbone with two phenyl groups and a dimethyl-substituted phenyl group, contributing to its unique chemical properties. This compound is typically a colorless to pale yellow liquid with a sweet, pleasant odor, making it useful in fragrance applications. It is moderately soluble in organic solvents but has limited solubility in water. The presence of multiple aromatic rings enhances its stability and reactivity, allowing it to participate in various chemical reactions, including Friedel-Crafts acylation and other electrophilic aromatic substitutions. Additionally, it may exhibit biological activity, which can be of interest in pharmaceutical research. Safety data indicates that it should be handled with care, as it may cause irritation upon contact with skin or eyes. Proper storage in a cool, dry place away from light is recommended to maintain its integrity.
Formula:C17H18O
InChI:InChI=1/C17H18O/c1-13-8-10-16(12-14(13)2)17(18)11-9-15-6-4-3-5-7-15/h3-8,10,12H,9,11H2,1-2H3
SMILES:Cc1ccc(cc1C)C(=O)CCc1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
