CAS 158525-81-6
:Benzamide, 3-chloro-N-(4-methoxyphenyl)-
Description:
Benzamide, 3-chloro-N-(4-methoxyphenyl)-, is an organic compound characterized by its benzamide structure, which consists of a benzene ring attached to a carbonyl group (C=O) and an amine (NH2) group. The specific compound features a chlorine atom at the 3-position of the benzene ring and a methoxy group (-OCH3) attached to a phenyl group at the nitrogen of the amide. This substitution pattern contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The presence of the chlorine atom can enhance the compound's electrophilicity, while the methoxy group may influence its electronic properties and steric hindrance. Benzamide derivatives are often studied for their biological activities, including potential pharmaceutical applications. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample.
Formula:C14H12ClNO2
InChI:InChI=1S/C14H12ClNO2/c1-18-13-7-5-12(6-8-13)16-14(17)10-3-2-4-11(15)9-10/h2-9H,1H3,(H,16,17)
InChI key:OASYJKCQPDJQQR-UHFFFAOYSA-N
SMILES:COC1=CC=C(C=C1)NC(=O)C2=CC(=CC=C2)Cl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery