CAS 158580-57-5

methyl 4-bromo-2-nitrobenzoate

Description:

Methyl 4-bromo-2-nitrobenzoate is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a bromine atom, a nitro group, and a methoxycarbonyl group. This compound is typically a yellow to brown solid at room temperature and is known for its moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water. The presence of the bromine and nitro substituents contributes to its reactivity, making it useful in various chemical synthesis applications, particularly in the field of medicinal chemistry and materials science. Methyl 4-bromo-2-nitrobenzoate can undergo nucleophilic substitution reactions and is often utilized as an intermediate in the synthesis of more complex organic molecules. Additionally, it may exhibit biological activity, which can be explored in pharmacological studies. Proper handling and storage are essential due to its potential toxicity and environmental impact, necessitating adherence to safety protocols in laboratory settings.

Formula: C₈H₆BrNO₄

InChI: InChI=1/C8H6BrNO4/c1-14-8(11)6-3-2-5(9)4-7(6)10(12)13/h2-4H,1H3

SMILES: COC(=O)c1ccc(cc1N(=O)=O)Br

Synonyms:

• Benzoic Acid, 4-Bromo-2-Nitro-, Methyl Ester

Benzoic acid, 4-bromo-2-nitro-, methyl ester

CAS: 158580-57-5

Formula: C₈H₆BrNO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 260.0415

Ref: IN-DA001QAX

Methyl 4-bromo-2-nitro-benzoate

CAS: 158580-57-5

Methyl 4-bromo-2-nitro-benzoate

Purity: 98%

Molecular weight: 260.04g/mol

Ref: 54-OR52909

Methyl 4-bromo-2-nitrobenzoate

CAS: 158580-57-5

Formula: C₈H₆BrNO₄

Purity: 98%

Color and Shape: Solid, Low Melting Solid

Molecular weight: 260.043

Ref: 10-F323852

Methyl 4-bromo-2-nitrobenzoate

CAS: 158580-57-5

Versatile small molecule scaffold

Formula: C₈H₆BrNO₄

Purity: Min. 95%

Molecular weight: 260.42 g/mol

Ref: 3D-IGA58057