CAS 15861-23-1

5-CYANO-2,3-DIHYDRO-1H-INDOLE

Description:

5-Cyano-2,3-dihydro-1H-indole is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a cyano group (-C≡N) at the 5-position contributes to its reactivity and potential applications in various chemical syntheses. This compound typically appears as a solid and is soluble in polar organic solvents. Its molecular structure allows for various functionalization reactions, making it of interest in medicinal chemistry and material science. The dihydro form indicates the saturation of the indole ring, which can influence its electronic properties and stability. Additionally, the compound may exhibit biological activity, making it a candidate for further research in pharmacology. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₉H₈N₂

InChI: InChI=1/C9H8N2/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-2,5,11H,3-4H2

SMILES: c1cc2c(CCN2)cc1C#N

Synonyms:

• Indoline-5-carbonitrile ,97%
• 2,3-dihydro-1H-indole-5-carbonitrile
• Indoline-5-carbonitrile

1H-Indole-5-carbonitrile, 2,3-dihydro-

CAS: 15861-23-1

Formula: C₉H₈N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 144.1732

Ref: IN-DA001QCK

5-Cyano-2,3-dihydro-1H-indole

CAS: 15861-23-1

5-Cyano-2,3-dihydro-1H-indole

Formula: C₉H₈N₂

Purity: 97%

Color and Shape: light yellow to brown solid

Molecular weight: 144.17g/mol

Ref: 54-OR953724

Indoline-5-carbonitrile

CAS: 15861-23-1

Purity: 98%

Molecular weight: 144.18

Ref: 10-F790837

5-Cyano-2,3-dihydro-1H-indole

Controlled Product

CAS: 15861-23-1

Applications 5-Cyano-2,3-dihydro-1H-indole

Formula: C₉H₈N₂

Color and Shape: Neat

Molecular weight: 144.17

Ref: TR-C955825