CAS 15861-30-0

2,3-DIHYDRO-1H-INDOLE-5-CARBOXYLIC ACID

Description:

2,3-Dihydro-1H-indole-5-carboxylic acid is an organic compound characterized by its bicyclic structure, which includes an indole moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. It is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols, reflecting its ability to engage in hydrogen bonding due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry, where it may serve as a building block for the synthesis of biologically active molecules. Its structural features suggest potential interactions with biological targets, making it a candidate for further research in drug development. Additionally, the presence of the dihydro group indicates that it may exhibit unique reactivity and stability compared to fully aromatic indole derivatives. Overall, 2,3-dihydro-1H-indole-5-carboxylic acid is a versatile compound with potential applications in pharmaceuticals and organic synthesis.

Formula: C₉H₉NO₂

InChI: InChI=1/C9H9NO2/c11-9(12)7-1-2-8-6(5-7)3-4-10-8/h1-2,5,10H,3-4H2,(H,11,12)

SMILES: c1cc2c(CCN2)cc1C(=O)O

Synonyms:

• Indoline-5-Carboxylic Acid
• Indoline-5-carboxylic acid ,97%

1H-Indole-5-carboxylic acid, 2,3-dihydro-

CAS: 15861-30-0

Formula: C₉H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.1733

Ref: IN-DA001QCI

Indoline-5-carboxylic acid

CAS: 15861-30-0

Indoline-5-carboxylic acid

Purity: 97%

Molecular weight: 163.176g/mol

Ref: 54-OR74307

Indoline-5-carboxylic acid

CAS: 15861-30-0

Formula: C₉H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.176

Ref: 10-F323658