CAS 15861-36-6
:1H-Indole-6-carbonitrile
Description:
1H-Indole-6-carbonitrile, with the CAS number 15861-36-6, is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a cyano group (-C≡N) at the 6-position of the indole ring contributes to its reactivity and potential applications in various chemical syntheses. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure allows for participation in diverse chemical reactions, including nucleophilic substitutions and cycloadditions, making it valuable in medicinal chemistry and the development of pharmaceuticals. Additionally, 1H-Indole-6-carbonitrile may exhibit biological activity, which has led to interest in its potential as a lead compound in drug discovery. Overall, its distinct structural features and reactivity profile make it a significant compound in both synthetic and medicinal chemistry contexts.
Formula:C9H6N2
InChI:InChI=1S/C9H6N2/c10-6-7-1-2-8-3-4-11-9(8)5-7/h1-5,11H
InChI key:InChIKey=SZSZDBFJCQKTRG-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C2C(=CC1)C=CN2
Synonyms:- 1H-Indole-6-carbonitrile
- Indole-6-carbonitrile
- 6-Cyano-1H-indole
- 6-Cyanoindole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
6-Cyanoindole
CAS:Formula:C9H6N2Purity:>98.0%(GC)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:142.161H-Indole-6-carbonitrile
CAS:1H-Indole-6-carbonitrile
Formula:C9H6N2Purity:98%Color and Shape: light orange to dark red/brown crystalline solidMolecular weight:142.16g/mol6-Cyanoindole
CAS:6-Cyanoindole is a synthetic compound that has been shown to have functional properties. It binds to the receptor of the chemokine, which is a type of protein that regulates inflammatory responses. It also inhibits the activity of coagulation factors, which are proteins involved in blood clotting. 6-Cyanoindole has been shown to inhibit cancer cell growth and induce apoptosis (cell death) in a number of cancer cell lines. The fluorescence properties and lifetimes of 6-cyanoindole have been studied extensively. It has also been used as a monomer in copolymerization reactions and is used as an intermediate in the synthesis of 6-bromoindole.
Formula:C9H6N2Purity:Min. 95%Color and Shape:White PowderMolecular weight:142.16 g/mol6-Cyanoindole
CAS:Formula:C9H6N2Purity:97%Color and Shape:Solid, Very pale yellow to yellow red solidMolecular weight:142.1616-Cyanoindole
CAS:6-Cyanoindole is a reactive intermediate in organic synthesis. It is used as a building block for the synthesis of other chemical compounds.Formula:C9H6N2Molecular weight:142.16 g/mol





