CAS 15862-30-3

3-Bromo-5-nitropyridine

Description:

3-Bromo-5-nitropyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with both a bromine atom and a nitro group. The bromine atom is located at the 3-position, while the nitro group is at the 5-position of the pyridine ring. This compound is typically a yellow to brown solid and is known for its aromatic properties, which contribute to its stability and reactivity. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water. 3-Bromo-5-nitropyridine is often used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to undergo various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of both the bromine and nitro groups makes it a versatile intermediate in the synthesis of more complex molecules. As with many nitro compounds, it should be handled with care due to potential toxicity and environmental concerns.

Formula: C₅H₃BrN₂O₂

InChI: InChI=1S/C5H3BrN2O2/c6-4-1-5(8(9)10)3-7-2-4/h1-3H

InChI key: InChIKey=WHYJVHQKKJHXTB-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=C(Br)C=NC1

Synonyms:

• 2-Bromo-5-Nitro Pyridine
• 3-Bromo-5-Nitropyridine
• 3-Nitro-5-Bromopyridine
• Pyridine, 3-bromo-5-nitro-

Pyridine, 3-bromo-5-nitro-

CAS: 15862-30-3

Formula: C₅H₃BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 202.9935

Ref: IN-DA001QDA

3-Bromo-5-nitropyridine

CAS: 15862-30-3

3-Bromo-5-nitropyridine

Purity: 98%

Molecular weight: 202.99g/mol

Ref: 54-OR345270

3-Bromo-5-nitropyridine

CAS: 15862-30-3

Formula: C₅H₃BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 202.995

Ref: 10-F076145