CymitQuimica logo

CAS 15864-53-6

:

3,6-dichloro-1,2-benzothiazole 1,1-dioxide

Description:
3,6-Dichloro-1,2-benzothiazole 1,1-dioxide, with the CAS number 15864-53-6, is an organic compound characterized by its benzothiazole structure, which features a fused benzene and thiazole ring. The presence of two chlorine atoms at the 3 and 6 positions of the benzothiazole ring contributes to its chemical reactivity and potential applications. The 1,1-dioxide functional group indicates the presence of two double-bonded oxygen atoms, which can enhance the compound's stability and influence its interactions with other substances. This compound is typically used in various industrial applications, including as a biocide and in the synthesis of other chemical products. It exhibits moderate solubility in organic solvents and is generally stable under standard conditions. However, like many chlorinated compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Its specific properties, such as melting point, boiling point, and reactivity, can vary based on the conditions and the presence of other chemicals.
Formula:C7H3Cl2NO2S
InChI:InChI=1/C7H3Cl2NO2S/c8-4-1-2-5-6(3-4)13(11,12)10-7(5)9/h1-3H
InChI key:VJJUJEMEUPXOOB-UHFFFAOYSA-N
SMILES:c1cc2c(cc1Cl)S(=O)(=O)N=C2Cl
Synonyms:
  • 1,2-Benzisothiazole, 3,6-dichloro-, 1,1-dioxide
  • 3,6-Dichloro-1,2-benzisothiazole 1,1-dioxide
Found 1 products.