CAS 158655-26-6

4-(1H-1,2,4-triazol-1-yl)piperidine

Description:

4-(1H-1,2,4-triazol-1-yl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a triazole moiety. The piperidine part contributes to its cyclic amine properties, while the triazole ring introduces heterocyclic characteristics, making it a potential candidate for various biological activities. This compound is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where it may exhibit antimicrobial, antifungal, or other therapeutic effects. Its molecular structure allows for interactions with biological targets, which can be crucial for drug development. Additionally, the presence of nitrogen atoms in both the piperidine and triazole rings can influence its solubility, stability, and reactivity. The compound's CAS number, 158655-26-6, serves as a unique identifier in chemical databases, facilitating research and information retrieval. Overall, 4-(1H-1,2,4-triazol-1-yl)piperidine represents a significant interest in the field of organic and medicinal chemistry due to its diverse potential applications.

Formula: C₇H₁₂N₄

InChI: InChI=1/C7H12N4/c1-3-8-4-2-7(1)11-6-9-5-10-11/h5-8H,1-4H2

SMILES: C1CNCCC1n1cncn1

Synonyms:

• piperidine, 4-(1H-1,2,4-triazol-1-yl)-

4-(1,2,4-triazol-1-yl)piperidine

CAS: 158655-26-6

Formula: C₇H₁₂N₄

Molecular weight: 152.1970

Ref: IN-DA001QPX

4-(1H-1,2,4-Triazol-1-yl)piperidine dihydrochloride

CAS: 158655-26-6

Versatile small molecule scaffold

Formula: C₇H₁₂N₄ClH

Purity: Min. 95%

Molecular weight: 225.12 g/mol

Ref: 3D-IGA65526