CAS 158669-26-2
:4-Iodo-2-methoxypyridine-3-carboxaldehyde
Description:
4-Iodo-2-methoxypyridine-3-carboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the iodo substituent at the 4-position and a methoxy group at the 2-position contributes to its unique reactivity and properties. The aldehyde functional group at the 3-position makes it a versatile intermediate in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for potential hydrogen bonding and dipole interactions, influencing its physical properties and reactivity. Additionally, the presence of the iodine atom can enhance the compound's electrophilic character, making it useful in nucleophilic substitution reactions. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings.
Formula:C7H6INO2
InChI:InChI=1/C7H6INO2/c1-11-7-5(4-10)6(8)2-3-9-7/h2-4H,1H3
SMILES:COc1c(C=O)c(ccn1)I
Synonyms:- 3-Pyridinecarboxaldehyde, 4-Iodo-2-Methoxy-
- 4-Iodo-2-methoxy-3-pyridinecarboxaldehyde
- 4-Iodo-2-methoxynicotinaldehyde
- T6Nj Bo1 Cvh Di [Wln]
- 4-Iodo-2-Methoxypyridine-3-Carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Pyridinecarboxaldehyde, 4-iodo-2-methoxy-
CAS:Formula:C7H6INO2Purity:96%Color and Shape:SolidMolecular weight:263.03254-Iodo-2-methoxynicotinaldehyde
CAS:4-Iodo-2-methoxynicotinaldehydePurity:98%Molecular weight:263.03g/mol4-Iodo-2-methoxynicotinaldehyde
CAS:Formula:C7H6INO2Purity:95%Color and Shape:SolidMolecular weight:263.0344-Iodo-2-methoxypyridine-3-carboxaldehyde
CAS:4-Iodo-2-methoxypyridine-3-carboxaldehyde is a disubstituted compound that has insulin-like properties. It inhibits the activity of the insulin receptor, which may contribute to its insulin-like growth factor effects. This inhibitor also targets the protein kinase, which is responsible for the response of cells to insulin. 4-Iodo-2-methoxypyridine 3 carboxaldehyde has been shown to inhibit IGF1R and malonate ion, and it may have potential as an oral treatment for diabetes.Formula:C7H6INO2Purity:Min. 95%Molecular weight:263.03 g/mol



