CymitQuimica logo

CAS 15869-85-9

:

5-Methylnonane

Description:
5-Methylnonane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. Its molecular formula is C10H22, indicating it consists of ten carbon atoms and twenty-two hydrogen atoms. This compound features a nonane backbone with a methyl group attached to the fifth carbon, which contributes to its branched structure. 5-Methylnonane is a colorless liquid at room temperature and is typically insoluble in water due to its hydrophobic nature, but it is soluble in organic solvents. It has a relatively high boiling point compared to straight-chain alkanes of similar molecular weight, reflecting the influence of branching on boiling point elevation. This compound is primarily of interest in the fields of organic chemistry and petrochemical research, where it may be studied for its properties as a fuel or solvent. Additionally, it can serve as a reference compound in various analytical applications, including gas chromatography. Safety data indicates that, like many hydrocarbons, it should be handled with care due to flammability and potential health hazards upon exposure.
Formula:C10H22
InChI:InChI=1S/C10H22/c1-4-6-8-10(3)9-7-5-2/h10H,4-9H2,1-3H3
InChI key:InChIKey=TYSIILFJZXHVPU-UHFFFAOYSA-N
SMILES:C(CCCC)(CCCC)C
Synonyms:
  • 5-Methylnonane
  • Nonane, 5-methyl-
Found 6 products.