CAS 15869-86-0: 4-Ethyloctane

Description:4-Ethyloctane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. It consists of a straight-chain octane backbone with an ethyl group attached to the fourth carbon atom. This structure contributes to its physical and chemical properties, including a relatively high boiling point and low volatility compared to shorter-chain hydrocarbons. 4-Ethyloctane is typically a colorless liquid at room temperature and is insoluble in water but soluble in organic solvents. Its molecular formula is C10H22, indicating it contains ten carbon atoms and twenty-two hydrogen atoms. As a hydrocarbon, it is non-polar and exhibits hydrophobic characteristics. 4-Ethyloctane is primarily used in research and industrial applications, particularly in the formulation of fuels and lubricants, where it can influence properties such as octane rating and viscosity. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may pose health risks upon prolonged exposure.

Formula:C₁₀H₂₂

InChI:InChI=1S/C10H22/c1-4-7-9-10(6-3)8-5-2/h10H,4-9H2,1-3H3

InChI key:InChIKey=NRJUFUBKIFIKFI-UHFFFAOYSA-N

SMILES:CCCCC(CC)CCC