CymitQuimica logo

CAS 15871-78-0

:

[5-Hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridinyl]methyl 3-pyridinecarboxylate

Description:
[5-Hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridinyl]methyl 3-pyridinecarboxylate, with the CAS number 15871-78-0, is a chemical compound that belongs to the class of pyridine derivatives. This substance is characterized by its complex molecular structure, which includes multiple functional groups such as hydroxyl and carboxylate moieties. The presence of hydroxymethyl and methyl groups contributes to its unique reactivity and potential biological activity. It is often studied for its pharmacological properties, particularly in relation to its effects on various biological systems. The compound may exhibit solubility in polar solvents due to its hydroxyl groups, while its pyridine rings can participate in various chemical interactions, including hydrogen bonding and coordination with metal ions. Its synthesis and applications are of interest in medicinal chemistry, where it may serve as a lead compound for drug development or as an intermediate in the synthesis of more complex molecules. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C14H14N2O4
InChI:InChI=1S/C14H14N2O4/c1-9-13(18)12(7-17)11(6-16-9)8-20-14(19)10-3-2-4-15-5-10/h2-6,17-18H,7-8H2,1H3
InChI key:InChIKey=LOZUXFQXMUUIGR-UHFFFAOYSA-N
SMILES:C(OC(=O)C=1C=CC=NC1)C=2C(CO)=C(O)C(C)=NC2
Synonyms:
  • [5-Hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridyl]methyl nicotinate
  • Nicotinic acid, [5-hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridyl]methyl ester
  • 3-Pyridinecarboxylic acid, [5-hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridinyl]methyl ester
  • [5-Hydroxy-4-(hydroxymethyl)-6-methyl-3-pyridinyl]methyl 3-pyridinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.