CAS 15872-44-3
:4-(Undecyloxy)benzoic acid
Description:
4-(Undecyloxy)benzoic acid, with the CAS number 15872-44-3, is an organic compound characterized by its long hydrophobic undecyloxy chain attached to a benzoic acid moiety. This structure imparts both hydrophilic and hydrophobic properties, making it amphiphilic. The compound typically exhibits a white to off-white solid appearance and is soluble in organic solvents while having limited solubility in water. Its molecular structure includes a carboxylic acid functional group, which can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound is often studied for its potential applications in materials science, particularly in the development of liquid crystals and surfactants. Additionally, its unique properties may allow for use in drug delivery systems or as a component in polymer formulations. The presence of the undecyloxy group enhances its ability to interact with lipid membranes, which is significant in biological contexts. Overall, 4-(Undecyloxy)benzoic acid is a versatile compound with a range of potential applications in various fields of chemistry and materials science.
Formula:C18H28O3
InChI:InChI=1S/C18H28O3/c1-2-3-4-5-6-7-8-9-10-15-21-17-13-11-16(12-14-17)18(19)20/h11-14H,2-10,15H2,1H3,(H,19,20)
InChI key:InChIKey=NEJZHJHZOUISSH-UHFFFAOYSA-N
SMILES:O(CCCCCCCCCCC)C1=CC=C(C(O)=O)C=C1
Synonyms:- 15872-44-3
- 4-(Undecyloxy)Benzoic Acid
- Benzoic acid, 4-(undecyloxy)-
- Benzoic acid, p-(undecyloxy)-
- p-Undecyloxybenzoic Acid
- p-n-Undecyloxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 4-(undecyloxy)-
CAS:Formula:C18H28O3Purity:98%Color and Shape:SolidMolecular weight:292.41314-Undecyloxybenzoic acid
CAS:4-Undecyloxybenzoic Acid is a secretory phospholipase that has been shown to have a phase transition temperature of 17.5°C, which is the lowest among all secretory phospholipases. It is a cytosolic enzyme that belongs to the group of serine hydrolases. The functional theory for 4-undecyloxybenzoic acid is based on the sequence of amino acids and hydrogen bonds between the enzyme and substrates. This enzyme has been shown to be effective in photocatalytic reactions with UV light.
Formula:C18H28O3Purity:Min. 95%Color and Shape:PowderMolecular weight:292.41 g/mol



