CAS 15872-46-5
:4-Tetradecyloxybenzoic Acid
Description:
4-Tetradecyloxybenzoic acid is an organic compound characterized by its long hydrophobic alkyl chain and a carboxylic acid functional group. It features a tetradecyl group (a 14-carbon straight-chain alkyl) attached to a benzoic acid structure via an ether linkage, specifically at the para position of the aromatic ring. This compound is typically a white to off-white solid at room temperature and is known for its amphiphilic properties, which allow it to interact with both hydrophilic and hydrophobic environments. It has applications in various fields, including materials science, where it is used in the synthesis of liquid crystals and surfactants. The presence of the long alkyl chain contributes to its ability to form micelles and influence the solubility of other compounds. Additionally, 4-tetradecyloxybenzoic acid may exhibit thermal stability and specific phase transition behaviors, making it of interest in the study of phase change materials and other advanced applications.
Formula:C21H34O3
InChI:InChI=1/C21H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-18-24-20-16-14-19(15-17-20)21(22)23/h14-17H,2-13,18H2,1H3,(H,22,23)
SMILES:CCCCCCCCCCCCCCOc1ccc(cc1)C(=O)O
Synonyms:- 4-N-tetradecyloxybenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

