
CAS 15872-89-6
:Diheptyl succinate
Description:
Diheptyl succinate, with the CAS number 15872-89-6, is an ester formed from the reaction of heptanol and succinic acid. It is characterized by its relatively high molecular weight and hydrophobic nature, which contributes to its low solubility in water. This compound typically appears as a colorless to pale yellow liquid with a mild odor. Diheptyl succinate is known for its use as a plasticizer, enhancing the flexibility and durability of polymers. Additionally, it may serve as a solvent in various applications due to its favorable viscosity and thermal stability. The substance is generally considered to have low toxicity, making it suitable for use in consumer products. Its chemical structure features a succinate backbone with two heptyl chains, which influences its physical properties, such as boiling point and melting point. Overall, diheptyl succinate is valued in industrial applications for its performance characteristics and compatibility with other materials.
Formula:C18H34O4
InChI:InChI=1S/C18H34O4/c1-3-5-7-9-11-15-21-17(19)13-14-18(20)22-16-12-10-8-6-4-2/h3-16H2,1-2H3
InChI key:InChIKey=PBZAGXRVDLNBCJ-UHFFFAOYSA-N
SMILES:C(CCC(OCCCCCCC)=O)(OCCCCCCC)=O
Synonyms:- Butanedioic acid, diheptyl ester
- Succinic acid, diheptyl ester
- Butanedioic acid, 1,4-diheptyl ester
- Diheptyl succinate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
