CymitQuimica logo

CAS 158727-56-1

:

2-Methoxy-4-(trifluoromethyl)aniline

Description:
2-Methoxy-4-(trifluoromethyl)aniline, with the CAS number 158727-56-1, is an organic compound characterized by its aniline structure, which features an amino group (-NH2) attached to a benzene ring. The presence of a methoxy group (-OCH3) at the second position and a trifluoromethyl group (-CF3) at the fourth position of the aromatic ring significantly influences its chemical properties. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. The trifluoromethyl group imparts unique electronic properties, enhancing the compound's lipophilicity and potentially affecting its reactivity and biological activity. Additionally, the methoxy group can participate in hydrogen bonding, influencing the compound's interactions in various chemical environments. 2-Methoxy-4-(trifluoromethyl)aniline may be of interest in pharmaceutical research and materials science due to its potential applications in drug development and as a building block in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H8F3NO
InChI:InChI=1S/C8H8F3NO/c1-13-7-4-5(8(9,10)11)2-3-6(7)12/h2-4H,12H2,1H3
InChI key:LWKZYZZCYQWRTJ-UHFFFAOYSA-N
SMILES:COC1=C(C=CC(=C1)C(F)(F)F)N
Found 4 products.